CAS 1873-51-4
:3-METHYLQUINOLINE-4-CARBOXYLIC ACID
Description:
3-Methylquinoline-4-carboxylic acid is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features a methyl group at the 3-position and a carboxylic acid functional group at the 4-position of the quinoline ring. It typically appears as a solid or crystalline substance and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the carboxylic acid group makes it a weak acid, capable of participating in various chemical reactions, including esterification and amidation. 3-Methylquinoline-4-carboxylic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other complex organic molecules. Additionally, it may exhibit fluorescence properties, making it useful in certain analytical applications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C11H9NO2
InChI:InChI=1/C11H9NO2/c1-7-6-12-9-5-3-2-4-8(9)10(7)11(13)14/h2-6H,1H3,(H,13,14)
Synonyms:- 4-Quinolinecarboxylic acid, 3-methyl-
- 3-METHYLQUINOLINE-4-CARBOXYLIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Methylquinoline-4-carboxylic acid
CAS:3-Methylquinoline-4-carboxylic acid is a functional compound that is used in pharmaceutical formulations to stabilize the active ingredient. It is often used as a preservative in topical formulations because it can inhibit the growth of bacteria and fungi. 3-Methylquinoline-4-carboxylic acid has been shown to inhibit fatty acids such as methyl esters and organic acids, which are key components of many enzymes. 3-Methylquinoline-4-carboxylic acid also has been shown to be an inhibitor of hippuric acid, an acidic substance that is excreted by the kidneys. This product can be found in acidic or neutral conditions, depending on its function.
Formula:C11H9NO2Purity:Min. 95%Molecular weight:187.19 g/mol
