CAS 1873-55-8
:3-Methylquinoline N-oxide
Description:
3-Methylquinoline N-oxide is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a methyl group at the third position of the quinoline ring contributes to its unique properties. This compound is typically a pale yellow to brown solid and is known for its role as a reagent in various chemical reactions, particularly in organic synthesis and as a potential probe in biological studies. It exhibits moderate solubility in polar solvents, which can influence its reactivity and interaction with other substances. 3-Methylquinoline N-oxide is also recognized for its potential applications in the fields of medicinal chemistry and materials science, where it may serve as a precursor for the synthesis of more complex molecules. Additionally, it is important to handle this compound with care, as it may pose health risks if ingested or inhaled, necessitating appropriate safety measures during its use in laboratory settings.
Formula:C10H9NO
InChI:InChI=1/C10H9NO/c1-8-6-9-4-2-3-5-10(9)11(12)7-8/h2-7H,1H3
SMILES:Cc1cc2ccccc2n(=O)c1
Synonyms:- 3-Methylquinoline 1-Oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Methylquinoline N-oxide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H9NOPurity:97%Color and Shape:Crystals or powder or crystalline powder or granules, Yellow to pale brownMolecular weight:159.193-Methylquinoline N-oxide
CAS:3-Methylquinoline N-oxidePurity:98%Color and Shape:Pale Brown SolidMolecular weight:159.18g/mol



