CAS 1873-89-8: Tris(trimethylsiloxy)silane
Description:Tris(trimethylsiloxy)silane, with the CAS number 1873-89-8, is a silane compound characterized by its unique structure, which includes three trimethylsiloxy groups attached to a silicon atom. This compound is typically a colorless, viscous liquid that exhibits low volatility and high thermal stability, making it suitable for various applications in materials science and surface modification. Its siloxy groups contribute to its hydrophobic properties, enhancing its utility as a surface treatment agent for glass, ceramics, and metals. Additionally, Tris(trimethylsiloxy)silane can act as a coupling agent, promoting adhesion between organic and inorganic materials. The compound is also used in the synthesis of silicone polymers and as a precursor in the production of silicate materials. Due to its silane nature, it can participate in hydrolysis reactions, leading to the formation of silanol groups, which can further polymerize or react with other substrates. Overall, its versatility and chemical stability make it a valuable compound in various industrial applications.
Formula:C9H28O3Si4
InChI:InChI=1S/C9H28O3Si4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h13H,1-9H3
InChI key:InChIKey=FDWGGTLVZGTDGQ-UHFFFAOYSA-N
SMILES:O([SiH](O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C
- Synonyms:
- 1,1,1,5,5,5-Hexamethyl-3-[(Trimethylsilyl)Oxy]Trisiloxane
- 3,3,3-Trimethyl-1,1-Bis[(Trimethylsilyl)Oxy]Disiloxanyl
- S 1003Ts
- Tris(Trimethylsilyloxy)Silane
- Trisiloxane, 1,1,1,5,5,5-hexamethyl-3-(trimethylsiloxy)-
- Trisiloxane, 1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]-
- Tris(trimethylsiloxy)silane
