CAS 1873-92-3
:Dichloromethyl-2-propen-1-ylsilane
Description:
Dichloromethyl-2-propen-1-ylsilane, with the CAS number 1873-92-3, is an organosilicon compound characterized by the presence of both silicon and chlorine atoms in its structure. It typically appears as a colorless to pale yellow liquid and has a pungent odor. This compound is notable for its reactivity, particularly due to the presence of the vinyl group, which can participate in various chemical reactions, including polymerization and cross-linking processes. The dichloromethyl group contributes to its potential as a silane coupling agent, enhancing adhesion between organic and inorganic materials. In terms of safety, it is classified as a hazardous substance, requiring careful handling due to its corrosive nature and potential to cause skin and respiratory irritation. Its applications are primarily found in the fields of materials science and organic synthesis, where it serves as an intermediate in the production of silicone polymers and other functionalized silanes. Proper storage and usage protocols are essential to mitigate risks associated with its chemical properties.
Formula:C4H8Cl2Si
InChI:InChI=1S/C4H8Cl2Si/c1-3-4-7(2,5)6/h3H,1,4H2,2H3
InChI key:InChIKey=YCEQUKAYVABWTE-UHFFFAOYSA-N
SMILES:C([Si](C)(Cl)Cl)C=C
Synonyms:- Allylmethyldichlorosilane
- Dichloromethyl-2-propen-1-ylsilane
- Silane, allyldichloromethyl-
- Silane, dichloromethyl-2-propen-1-yl-
- Silane, dichloromethyl-2-propenyl-
- Allyldichloromethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

