CymitQuimica logo

CAS 187324-67-0

:

(1S,2R)-2-[Benzyl(mesitylsulfonyl)amino]-1-phenylpropyl propionate

Description:
The chemical substance known as (1S,2R)-2-[Benzyl(mesitylsulfonyl)amino]-1-phenylpropyl propionate, with the CAS number 187324-67-0, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a propionate ester moiety, which contributes to its solubility and reactivity. The presence of a benzyl group and a mesitylsulfonyl group indicates that it has significant steric bulk and potential for various interactions, making it of interest in medicinal chemistry and drug design. The stereochemical configuration (1S,2R) suggests that the compound may exhibit specific biological activity or selectivity due to its three-dimensional arrangement. Additionally, the sulfonamide functionality can enhance its pharmacological properties, such as improving metabolic stability or modulating biological targets. Overall, this compound's unique structure and functional groups may contribute to its potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry.
Formula:C28H33NO4S
InChI:InChI=1/C28H33NO4S/c1-6-26(30)33-27(25-15-11-8-12-16-25)23(5)29(19-24-13-9-7-10-14-24)34(31,32)28-21(3)17-20(2)18-22(28)4/h7-18,23,27H,6,19H2,1-5H3/t23-,27-/m1/s1
SMILES:CCC(=O)O[C@H]([C@@H](C)N(Cc1ccccc1)S(=O)(=O)c1c(C)cc(C)cc1C)c1ccccc1
Synonyms:
  • Propionic acid (1S,2R)-2-[N-benzyl-N-(mesitylenesulfonyl)amino]-1-phenylpropyl ester
  • (1S,2R)-2-{benzyl[(2,4,6-trimethylphenyl)sulfonyl]amino}-1-phenylpropyl propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.