![N-[[2-[[[4-[(E)-Amino[[(2-ethylbutoxy)carbonyl]imino]methyl]phenyl]amino]methyl]-1-methyl-1H-benzi…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F477101-n-2-4-e-amino-2-ethylbutoxy-carbonyl-imino-methyl-phenyl-amino-methyl-1-methyl-1h-benzimidazol-5-yl-carbonyl-n-2-pyridinyl-b-alanine-ethyl-ester.webp&w=3840&q=75)
CAS 1873316-01-8
:N-[[2-[[[4-[(E)-Amino[[(2-ethylbutoxy)carbonyl]imino]methyl]phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester
Description:
The chemical substance N-[[2-[[[4-[(E)-Amino[[(2-ethylbutoxy)carbonyl]imino]methyl]phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester, with CAS number 1873316-01-8, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole core, which is known for its biological activity, and incorporates various functional groups such as amino, carbonyl, and ester moieties. The presence of the ethyl ester group suggests potential lipophilicity, which may influence its solubility and permeability properties. Additionally, the compound contains a pyridine ring, contributing to its aromatic character and possibly enhancing its interaction with biological targets. The overall structure indicates potential applications in medicinal chemistry, particularly in drug design, due to its diverse functional groups that may facilitate interactions with biomolecules. However, specific properties such as melting point, solubility, and biological activity would require empirical data for comprehensive characterization.
Formula:C34H41N7O5
InChI:InChI=1S/C34H41N7O5/c1-5-23(6-2)22-46-34(44)39-32(35)24-11-14-26(15-12-24)37-21-30-38-27-20-25(13-16-28(27)40(30)4)33(43)41(19-17-31(42)45-7-3)29-10-8-9-18-36-29/h8-16,18,20,23,37H,5-7,17,19,21-22H2,1-4H3,(H2,35,39,44)
InChI key:InChIKey=FLKVNYQKJOGRLQ-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(N(CCC(OCC)=O)C3=CC=CC=N3)=O)=CC2)N=C1CNC4=CC=C(C(NC(OCC(CC)CC)=O)=N)C=C4
Synonyms:- N-[[2-[[[4-[(E)-Amino[[(2-ethylbutoxy)carbonyl]imino]methyl]phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester
- β-Alanine, N-[[2-[[[4-[(E)-amino[[(2-ethylbutoxy)carbonyl]imino]methyl]phenyl]amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dabigatran Etexilate Related Compound C (Ethyl 3-(2-{[(4-{N'-[(2-ethylbutoxy)carbonyl]carbamimidoyl}phenyl)amino]methyl}-1-methyl-N-(pyridin-2-yl)-1H-benzimidazole-5-carboxamido)propanoate)
CAS:Compounds containing an unfused pyridine ring in the structure, nesoiFormula:C34H41N7O5Color and Shape:PowderMolecular weight:627.31692CBDA 510 BS
CAS:Controlled Product<p>Applications CBDA 510 BS is a useful research chemical.<br></p>Formula:C34H41N7O5Color and Shape:NeatMolecular weight:627.75CBDA 510 bS
CAS:<p>CBDA 510 bS is a medicinal compound that acts as a kinase inhibitor and analog. It has been shown to induce apoptosis in cancer cells, making it a promising anticancer agent. CBDA 510 bS inhibits the activity of kinases involved in cell cycle regulation and protein synthesis, leading to decreased tumor growth. Additionally, it has been found to inhibit the growth of Chinese hamster ovary cells and human colon cancer cells. This compound may also have potential as an inhibitor of xylan-degrading enzymes, which could be useful in the development of new cancer therapies. With its potent anticancer properties, CBDA 510 bS is an exciting new area of research for those looking for effective cancer treatments.</p>Formula:C34H41N7O5Purity:Min. 95%Molecular weight:627.7 g/mol
