
CAS 187337-07-1
:pyrisulfoxin A
Description:
Pyrisulfoxin A, with the CAS number 187337-07-1, is a chemical compound that belongs to the class of sulfoxides. It is characterized by the presence of a sulfoxide functional group, which consists of a sulfur atom bonded to an oxygen atom and to two carbon-containing groups. This compound is notable for its potential biological activity, particularly in the context of agricultural applications, where it may serve as a fungicide or pesticide. Pyrisulfoxin A exhibits properties that can influence its solubility, stability, and reactivity, making it of interest in both synthetic and applied chemistry. Its molecular structure contributes to its interactions with biological systems, which can lead to various effects on target organisms. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact. Further research may be necessary to fully understand its mechanisms of action and to evaluate its efficacy and safety in practical applications.
Formula:C13H13N3O3S
Synonyms:- pyrisulfoxin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrisulfoxin A
CAS:Pyrisulfoxin A is an antibiotic that can be found in Streptomyces callfornicus [BS-75].Formula:C13H13N3O3SColor and Shape:SolidMolecular weight:291.326
