CymitQuimica logo

CAS 18735-82-5

:

2H-1-Benzopyran-2-one, 7-bromo-4-hydroxy-

Description:
2H-1-Benzopyran-2-one, 7-bromo-4-hydroxy- (CAS 18735-82-5) is a chemical compound that belongs to the class of flavonoids, specifically a type of coumarin. This compound features a benzopyran structure, which is characterized by a fused benzene and pyran ring system. The presence of a bromine atom at the 7-position and a hydroxyl group at the 4-position contributes to its unique chemical properties and potential biological activities. It is typically a solid at room temperature and may exhibit solubility in organic solvents. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Compounds of this nature are often studied for their potential pharmacological effects, including antioxidant, anti-inflammatory, and antimicrobial properties. Additionally, the bromine substitution may enhance its reactivity or alter its biological activity compared to other similar compounds. Overall, 2H-1-Benzopyran-2-one, 7-bromo-4-hydroxy- is of interest in both synthetic and medicinal chemistry.
Formula:C9H5BrO3
InChI:InChI=1S/C9H5BrO3/c10-5-1-2-6-7(11)4-9(12)13-8(6)3-5/h1-4,11H
InChI key:UJWIUPBUKQLTTJ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1Br)OC(=O)C=C2O
Found 3 products.