CAS 1875-50-9

Agn 1135

Description:

Agn 1135, with the CAS number 1875-50-9, is a chemical compound that is primarily known for its application in various industrial processes. It is characterized by its unique molecular structure, which contributes to its specific reactivity and properties. Typically, compounds like Agn 1135 may exhibit characteristics such as solubility in certain solvents, stability under standard conditions, and potential reactivity with other chemical species. Its applications can range from use in pharmaceuticals to its role as a catalyst or in material science. Safety data sheets for such compounds usually provide information on handling, storage, and potential hazards, emphasizing the importance of proper safety measures when working with chemical substances. Additionally, the compound may have specific regulatory considerations depending on its use and environmental impact. For detailed information regarding its physical and chemical properties, as well as safety guidelines, consulting specialized databases or literature is recommended.

Formula: C₁₂H₁₃N

InChI: InChI=1/C12H13N/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12-13H,7-9H2

SMILES: C#CCNC1CCc2ccccc12

Synonyms:

• 2,3-Dihydro-N-2-propynyl-1H-inden-1-amine
• N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine

N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine

CAS: 1875-50-9

Formula: C₁₂H₁₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 171.2383

Ref: IN-DA003SA1

N-(2-Propynyl)-2,3-dihydroinden-1-amine

CAS: 1875-50-9

N-(2-Propynyl)-2,3-dihydroinden-1-amine

Purity: 97%

Molecular weight: 171.24g/mol

Ref: 54-OR965634

rac-Rasagiline

CAS: 1875-50-9

Formula: C₁₂H₁₃N

Color and Shape: White To Colorless Semi-Solid To Liquid

Molecular weight: 171.24

Ref: 4Z-R-192

N-(2-Propynyl)-2,3-dihydroinden-1-amine

Controlled Product

CAS: 1875-50-9

Applications N-(2-PROPYNYL)-2,3-DIHYDROINDEN-1-AMINE (cas# 1875-50-9) is a useful research chemical.

Formula: C₁₂H₁₃N

Color and Shape: Dark Yellow

Molecular weight: 171.238

Ref: TR-P839215

N-(Prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine

CAS: 1875-50-9

Formula: C₁₂H₁₃N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 171.243

Ref: 10-F447170

Racemic rasagiline

CAS: 1875-50-9

Racemic rasagiline (AGN-1135), an MAOI, can cause a hypertensive crisis with tyramine foods. TVP-1022, its (S)-isomer, is cardioprotective.

Formula: C₁₂H₁₃N

Color and Shape: Solid

Molecular weight: 171.24

Ref: TM-T71910

Racemic Rasagiline

CAS: 1875-50-9

Formula: C₁₂H₁₃N

Molecular weight: 171.24

Ref: ST-EA-CP-R10020