CymitQuimica logo

CAS 1875-72-5

:

2-Naphthalenesulfonyl chloride, 6-methyl-

Description:
2-Naphthalenesulfonyl chloride, 6-methyl- is an organic compound characterized by the presence of a naphthalene ring substituted with a sulfonyl chloride group and a methyl group at the 6-position. This compound typically appears as a solid and is known for its reactivity due to the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The presence of the naphthalene moiety contributes to its aromatic properties, which can influence its solubility and reactivity. Additionally, the compound may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its applications extend to various fields, including pharmaceuticals and materials science, where it serves as an intermediate in the synthesis of more complex molecules.
Formula:C11H9ClO2S
InChI:InChI=1S/C11H9ClO2S/c1-8-2-3-10-7-11(15(12,13)14)5-4-9(10)6-8/h2-7H,1H3
InChI key:InChIKey=OXHYCRDRXFZPMW-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC2=C(C=C1)C=C(C)C=C2
Synonyms:
  • Menasyl chloride
  • 6-Methyl-2-naphthalenesulfonyl chloride
  • 2-Naphthalenesulfonyl chloride, 6-methyl-
Found 2 products.