CymitQuimica logo

CAS 18751-91-2

:

2-amino-4,5-hexadienoic acid

Description:
2-Amino-4,5-hexadienoic acid, also known as L-arginine or by its CAS number 18751-91-2, is an amino acid characterized by its unique structure that includes a six-carbon chain with two double bonds and an amino group. This compound is classified as a non-essential amino acid, meaning that it can be synthesized by the body. It plays a crucial role in various biological processes, including protein synthesis, the production of nitric oxide, and the regulation of blood flow. The presence of the amino group (-NH2) and the carboxylic acid group (-COOH) makes it a zwitterionic molecule at physiological pH, allowing it to participate in various biochemical reactions. Additionally, 2-amino-4,5-hexadienoic acid is involved in metabolic pathways and can act as a precursor for other important biomolecules. Its solubility in water and ability to form salts further enhance its biological relevance. Overall, this compound is significant in both nutrition and biochemistry, contributing to various physiological functions.
Formula:C6H9NO2
InChI:InChI=1/C6H9NO2/c1-2-3-4-5(7)6(8)9/h3,5H,1,4,7H2,(H,8,9)
SMILES:C=C=CCC(C(=O)O)N
Synonyms:
  • 4,5-Hexadienoic acid, 2-amino-
  • 2-Aminohexa-4,5-Dienoic Acid
  • 2-Amino-4,5-hexadienoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Allenic Norleucine

    Controlled Product
    CAS:
    Formula:C6H9NO2
    Color and Shape:Neat
    Molecular weight:127.141

    Ref: TR-A542000

    50mg
    1,438.00€