CymitQuimica logo

CAS 187725-00-4

:

1H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 4-chloro-, ethyl ester

Description:
1H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 4-chloro-, ethyl ester is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a carboxylic acid functional group that is esterified with an ethyl group, enhancing its solubility and reactivity. The presence of a chlorine atom at the 4-position of the pyrimidine ring contributes to its chemical properties, potentially influencing its reactivity and biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for various interactions, including hydrogen bonding and pi-stacking, which can be significant in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituent and the ester group. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development and other fields of chemistry.
Formula:C9H8ClN3O2
InChI:InChI=1/C9H8ClN3O2/c1-2-15-9(14)6-3-5-7(10)11-4-12-8(5)13-6/h3-4H,2H2,1H3,(H,11,12,13)
InChI key:BMVGJDTURCUCNP-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc2c(Cl)ncnc2[nH]1
Synonyms:
  • ethyl 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate
Found 4 products.