CAS 18774-47-5

2-amino-1-benzothiophene-3-carbonitrile

Description:

2-Amino-1-benzothiophene-3-carbonitrile is an organic compound characterized by its unique structure, which includes a benzothiophene core, an amino group, and a cyano group. The presence of the thiophene ring contributes to its aromatic properties, while the amino group can participate in hydrogen bonding, enhancing its reactivity and solubility in polar solvents. The cyano group introduces a strong electron-withdrawing characteristic, which can influence the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or cycloadditions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-amino-1-benzothiophene-3-carbonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₉H₆N₂S

InChI: InChI=1/C9H6N2S/c10-5-7-6-3-1-2-4-8(6)12-9(7)11/h1-4H,11H2

SMILES: c1ccc2c(c1)c(C#N)c(N)s2

Synonyms:

• Benzo[b]thiophene-3-carbonitrile, 2-amino-
• 2-Amino-1-benzothiophene-3-carbonitrile

Benzo[b]thiophene-3-carbonitrile, 2-amino-

CAS: 18774-47-5

Formula: C₉H₆N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.2223

Ref: IN-DA002GGP

2-Aminobenzo[b]thiophene-3-carbonitrile

CAS: 18774-47-5

2-Aminobenzo[b]thiophene-3-carbonitrile

Purity: 97%

Molecular weight: 174.228g/mol

Ref: 54-OR74582

2-Aminobenzo[b]thiophene-3-carbonitrile

CAS: 18774-47-5

Formula: C₉H₆N₂S

Purity: 97%

Molecular weight: 174.22

Ref: 10-F209649