CAS 1878-51-9
:2-(3-Ethylphenoxy)acetic acid
Description:
2-(3-Ethylphenoxy)acetic acid, with the CAS number 1878-51-9, is an organic compound characterized by its phenoxyacetic acid structure. It features a phenyl ring substituted with an ethyl group at the meta position and an acetic acid moiety. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, with limited solubility in water due to its hydrophobic phenyl group. It exhibits properties typical of carboxylic acids, including the ability to form hydrogen bonds, which can influence its reactivity and interactions in biological systems. 2-(3-Ethylphenoxy)acetic acid is of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific applications can vary, but it is often studied for its potential biological activity and role in plant growth regulation. As with many organic compounds, handling should be done with care, considering safety data and potential environmental impacts.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-2-8-4-3-5-9(6-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)
InChI key:InChIKey=UPXZHPLISDBGJG-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(CC)=CC=C1
Synonyms:- (3-Ethylphenoxy)Acetate
- 2-(3-Ethylphenoxy)acetic acid
- 3-Ethylphenoxyacetic acid
- Acetic acid, (3-ethylphenoxy)-
- Acetic acid, (m-ethylphenoxy)-
- Acetic acid, 2-(3-ethylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(3-Ethylphenoxy)acetic acid
CAS:<p>2-(3-Ethylphenoxy)acetic acid is a phenoxyacetic acid that can be used as an igniting agent. It can be synthesized by the reaction of an alcohol with a carboxylic acid chloride in the presence of a base. The compound weighs 130.2 g/mol and has a melting point of 50°C. 2-(3-Ethylphenoxy)acetic acid is often used as a reagent for weighing zirconium oxide, which is used in some dental prostheses and dentures. It reacts with zirconia to produce ZrO2 and CO2 gas. The compound also reacts with water to form hydrogen gas, which makes it useful as a catalyst for oxidation reactions when heating zirconium metal in air.</p>Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol


