CAS 1878-52-0
:2-[3-(1-Methylethyl)phenoxy]acetic acid
Description:
2-[3-(1-Methylethyl)phenoxy]acetic acid, commonly known as Mefenamic acid, is a non-steroidal anti-inflammatory drug (NSAID) that exhibits analgesic and antipyretic properties. It is characterized by its ability to inhibit cyclooxygenase enzymes, leading to a decrease in the synthesis of prostaglandins, which are mediators of inflammation and pain. The compound typically appears as a white to off-white crystalline powder and is soluble in organic solvents like ethanol and dimethyl sulfoxide, but has limited solubility in water. Its molecular structure features a phenoxy group attached to an acetic acid moiety, contributing to its pharmacological activity. Mefenamic acid is primarily used for the treatment of mild to moderate pain, including menstrual pain, and is often prescribed for its anti-inflammatory effects. As with other NSAIDs, it may have side effects, including gastrointestinal discomfort and potential cardiovascular risks, necessitating careful consideration in its use. Overall, its effectiveness and mechanism of action make it a valuable option in pain management therapies.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-8(2)9-4-3-5-10(6-9)14-7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)
InChI key:InChIKey=WXLGLXXOGLYPMX-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(C(C)C)=CC=C1
Synonyms:- Acetic acid, (m-cumenyloxy)-
- Acetic acid, [3-(1-methylethyl)phenoxy]-
- 2-[3-(1-Methylethyl)phenoxy]acetic acid
- Acetic acid, 2-[3-(1-methylethyl)phenoxy]-
- 3-Isopropylphenoxyacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-[3-(propan-2-yl)phenoxy]acetic acid
CAS:2-[3-(propan-2-yl)phenoxy]acetic acidPurity:98%Molecular weight:194.23g/mol2-[3-(Propan-2-yl)phenoxy]acetic acid
CAS:2-[3-(Propan-2-yl)phenoxy]acetic acid is a chemical compound that is used as an additive in benzene, and is a phytotoxic chemical. It prevents the formation of chlorophyll by blocking electron transport and inhibiting photosynthesis. 2-[3-(Propan-2-yl)phenoxy]acetic acid is used to induce callus tissue from lettuce, radish, and other plants. This compound also inhibits the growth of various bacteria including Escherichia coli and Pseudomonas aeruginosa.
Formula:C11H14O3Purity:Min. 95%Molecular weight:194.23 g/molRef: 3D-BAA87852
Discontinued product



