CAS 1878-61-1
:3-(Carboxymethoxy)benzoic acid
Description:
3-(Carboxymethoxy)benzoic acid, also known as 3-Carboxymethoxybenzoic acid, is an aromatic carboxylic acid characterized by the presence of both a carboxylic acid group (-COOH) and a methoxy group (-OCH2COOH) attached to a benzene ring. This compound features a benzene ring substituted at the 3-position with a carboxymethoxy group, which contributes to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group. The compound can participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and pharmaceutical applications. Its structural features allow it to engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Overall, 3-(Carboxymethoxy)benzoic acid is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C9H8O5
InChI:InChI=1S/C9H8O5/c10-8(11)5-14-7-3-1-2-6(4-7)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13)
InChI key:InChIKey=GXFAJSDLPLCRIQ-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(C(O)=O)=CC=C1
Synonyms:- Benzoic acid, 3-(carboxymethoxy)-
- 3-(Carboxymethoxy)benzoic acid
- m-Anisic acid, α-carboxy-
- 3-Carboxyphenoxyacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzoic acid, 3-(carboxyMethoxy)-
CAS:Formula:C9H8O5Purity:95%Color and Shape:SolidMolecular weight:196.15683-(carboxymethoxy)benzoic acid
CAS:3-(Carboxymethoxy)benzoic acid is a monoanion with a carboxylate group. It is a centrosymmetric molecule that has hydrogen bonds between the anions and the cations. It interacts with other molecules in supramolecular chemistry, such as isonicotinamide and pyridinium. 3-(Carboxymethoxy)benzoic acid can be used as a ligand for various metal ions, including copper and nickel, which are found in proteins that have been shown to have antimicrobial properties. This compound has been shown to inhibit the growth of bacteria by targeting methylamine-N-oxide reductase, an enzyme involved in methylamine metabolism. The molecule also inhibits protein synthesis by binding to ribosomes.
Formula:C9H8O5Purity:Min. 95%Molecular weight:196.16 g/mol


