CAS 1878-62-2
:2-(2-Acetylphenoxy)acetic acid
Description:
2-(2-Acetylphenoxy)acetic acid, with the CAS number 1878-62-2, is an organic compound that belongs to the class of phenoxyacetic acids. It features a phenoxy group attached to an acetic acid moiety, with an acetyl substituent on the phenyl ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited. It exhibits characteristics typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. The presence of the acetyl group may impart specific biological activities, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, its structure suggests potential applications in synthesis and as an intermediate in organic reactions. As with many chemical substances, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c1-7(11)8-4-2-3-5-9(8)14-6-10(12)13/h2-5H,6H2,1H3,(H,12,13)
InChI key:InChIKey=GQZDTCFUDGMSOS-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(C(C)=O)C=CC=C1
Synonyms:- (2-Acetyl-phenoxy)-acetic acid
- 2-(2-Acetylphenoxy)acetic acid
- 2-Acetylphenoxyacetic acid
- Acetic acid, (o-acetylphenoxy)-
- Acetic acid, 2-(2-acetylphenoxy)-
- Acetic acid, (2-acetylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Acetic acid, 2-(2-acetylphenoxy)-
CAS:Formula:C10H10O4Purity:95%Color and Shape:SolidMolecular weight:194.1840(2-Acetyl-phenoxy)-acetic acid
CAS:(2-Acetyl-phenoxy)-acetic acidPurity:95%Molecular weight:194.18g/mol2-Acetylphenoxy acetic acid
CAS:Formula:C10H10O4Purity:95.0%Color and Shape:SolidMolecular weight:194.186(2-Acetyl-phenoxy)-acetic acid
CAS:(2-Acetyl-phenoxy)-acetic acid is a polymeric molecule that can be used as a herbivore-mediating agent. It is synthesized by chemoenzymatic reactions and has been shown to have an inhibitory effect on the lipase activity of plant cells, which may be mediated through the interaction with copper ions. (2-Acetyl-phenoxy)-acetic acid has also been found to be effective against planthoppers, such as Nilaparvata lugens, in screening tests.Formula:C10H10O4Purity:Min. 95%Molecular weight:194.19 g/mol



