CAS 1878-69-9
:3-Iodophenylacetic acid
Description:
3-Iodophenylacetic acid is an organic compound characterized by the presence of an iodine atom attached to a phenyl ring, which is further connected to an acetic acid functional group. Its molecular structure features a phenyl group substituted at the meta position with an iodine atom, contributing to its unique reactivity and properties. The compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the phenyl group. 3-Iodophenylacetic acid is often utilized in organic synthesis and medicinal chemistry, serving as an intermediate in the preparation of various pharmaceuticals and biologically active compounds. The presence of the iodine atom can enhance the compound's biological activity and influence its interaction with biological targets. Additionally, the compound may exhibit specific characteristics such as melting point and boiling point, which are essential for its handling and application in laboratory settings. Safety precautions should be observed when working with this compound due to its potential toxicity and reactivity.
Formula:C8H7IO2
InChI:InChI=1/C8H7IO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)
SMILES:c1cc(cc(c1)I)CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Iodophenylacetic Acid
CAS:Formula:C8H7IO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:262.053-Iodophenylacetic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H7IO2Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:262.05Benzeneacetic acid, 3-iodo-
CAS:Formula:C8H7IO2Purity:98%Color and Shape:SolidMolecular weight:262.0444Ref: IN-DA002GHW
1g28.00€5g55.00€10g84.00€25g155.00€50g202.00€100g507.00€250gTo inquire500gTo inquire100mg20.00€250mg25.00€3-Iodophenylacetic acid
CAS:3-Iodophenylacetic acidFormula:C8H7IO2Purity:97%Color and Shape: faint beige crystalline solidMolecular weight:262.04g/mol2-(3-Iodophenyl)acetic acid
CAS:<p>2-(3-Iodophenyl)acetic acid is a synthetic radiotracer that binds to dopamine receptors. It competes with the endogenous ligand dopamine and is used in positron emission tomography (PET) imaging to determine the distribution of dopamine receptors in various parts of the brain. 2-(3-Iodophenyl)acetic acid has a high affinity for dopamine D2 receptors, but its binding is not as selective as that of other PET radioligands such as raclopride, which binds more specifically to D2 receptors. This means that 2-(3-Iodophenyl)acetic acid can bind to other types of receptors, such as 5HT1A serotonin receptor or α1 adrenergic receptor. The uptake and reuptake rate constants are measured by modelling the data from radioactive tracer studies. These values depend on the concentration of 2-(3-Iodophenyl)acetic acid in different regions of the brain and can</p>Formula:C8H7IO2Purity:Min. 95%Molecular weight:262.04 g/mol





