CAS 1878-82-6
:(4-CYANO-PHENOXY)-ACETIC ACID
Description:
(4-Cyano-phenoxy)-acetic acid, with the CAS number 1878-82-6, is an organic compound characterized by its phenoxy and cyano functional groups. It features a phenolic ring substituted with a cyano group at the para position and an acetic acid moiety, which contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It exhibits potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to act as a herbicide or plant growth regulator. The cyano group enhances its reactivity and can participate in further chemical transformations. Additionally, (4-cyano-phenoxy)-acetic acid may exhibit biological activity, making it of interest for research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H6NO3
InChI:InChI=1/C9H7NO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,6H2,(H,11,12)/p-1
SMILES:c1cc(ccc1C#N)OCC(=O)[O-]
Synonyms:- (4-Cyanophenoxy)acetic acid
- Acetic acid, 2-(4-cyanophenoxy)-
- (4-Cyanophenoxy)Acetate
- (4-Cyano-phenoxy)-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(4-cyanophenoxy)-
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.1568(4-Cyanophenoxy)acetic acid
CAS:<p>4-Cyanophenoxyacetic acid is a traceless, magnetic and low temperature electrochemical oxidant. It has a symbol of CPA, and the chemical formula CHNO. 4-Cyanophenoxyacetic acid is an organic compound that can be used in sustainable chemistry to produce oxidants in low temperatures. This compound is able to reversibly switch between ferromagnetic and antiferromagnetic states at low temperatures. At higher temperatures, it reorients to the ferroelectric state. 4-Cyanophenoxyacetic acid is a strong oxidant with yields of up to 98% and reorientation at temperatures as high as 370 °C.</p>Formula:C9H7NO3Purity:Min. 95%Molecular weight:177.16 g/mol



