CAS 18781-31-2
:2-Acetyl-3-methylbenzo[b]thiophene
Description:
2-Acetyl-3-methylbenzo[b]thiophene is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with an acetyl group and a methyl group. This compound typically exhibits a yellow to brown color and is known for its aromatic properties, contributing to its potential applications in the field of organic synthesis and materials science. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and dichloromethane. The presence of the acetyl group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its stability under standard conditions and the ability to undergo further functionalization make it a valuable intermediate in the synthesis of more complex organic molecules. As with many thiophene derivatives, it may also display unique electronic properties, which can be harnessed in electronic applications.
Formula:C11H10OS
InChI:InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3
SMILES:Cc1c2ccccc2sc1C(=O)C
Synonyms:- 2-Acetyl-3-methylthianaphthene
- 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one
- 1-(3-Methyl-1-Benzothiophen-6-Yl)Ethanone
- 1-(3-Methyl-1-Benzothiophen-2-Yl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(3-methyl-1-benzothiophen-2-yl)ethan-1-one
CAS:Formula:C11H10OSPurity:95%Color and Shape:SolidMolecular weight:190.26152-Acetyl-3-methylbenzo[b]thiophene
CAS:2-Acetyl-3-methylbenzo[b]thiophenePurity:97%Color and Shape:CrystalsMolecular weight:190.26g/mol2-Acetyl-3-methylbenzo[b]thiophene
CAS:2-Acetyl-3-methylbenzo[b]thiophene is a serotonin transporter (SERT) inhibitor. It binds to the serotonin transporter and prevents it from transporting serotonin back into the presynaptic cell, thereby increasing the level of free serotonin in the synapse. 2-Acetyl-3-methylbenzo[b]thiophene has been shown to have high affinity for 5HT1A receptor, as well as substituents that are capable of binding to this receptor. This drug also has an antidepressant effect by inhibiting the reuptake of serotonin.Formula:C11H10OSPurity:Min. 95%Molecular weight:190.26 g/mol


