CymitQuimica logo

CAS 187884-87-3

:

N-(3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-beta-alanine

Description:
N-(3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-beta-alanine, with the CAS number 187884-87-3, is a chemical compound that features a beta-alanine moiety linked to a 3,3-dimethyl-3,4-dihydroisoquinoline structure. This compound is characterized by its unique bicyclic isoquinoline framework, which contributes to its potential biological activity. The presence of the dimethyl groups enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Beta-alanine, an amino acid, is known for its role in the synthesis of carnosine, a dipeptide that acts as a buffer in muscle tissues. The combination of these two structural elements may suggest applications in medicinal chemistry, particularly in the development of compounds targeting neurological or muscular functions. Additionally, the compound's stability, solubility, and reactivity can be influenced by its functional groups and overall molecular structure, making it a subject of interest for further research in drug development and biochemical applications.
Formula:C14H18N2O2
InChI:InChI=1/C14H18N2O2/c1-14(2)9-10-5-3-4-6-11(10)13(16-14)15-8-7-12(17)18/h3-6H,7-9H2,1-2H3,(H,15,16)(H,17,18)
SMILES:CC1(C)Cc2ccccc2C(=NCCC(=O)O)N1
Synonyms:
  • beta-Alanine, N-(3,4-dihydro-3,3-dimethyl-1-isoquinolinyl)-
  • N-(3,3-Dimethyl-3,4-dihydroisoquinolin-1-yl)-beta-alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.