CAS 1879-56-7
:O-Bromophenoxyacetic acid
Description:
O-Bromophenoxyacetic acid is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and a carboxylic acid functional group. It features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and an acetic acid moiety, making it a derivative of phenoxyacetic acid. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. O-Bromophenoxyacetic acid is known for its applications in herbicide formulations and as a plant growth regulator, influencing various physiological processes in plants. The presence of the bromine atom can enhance its biological activity and stability. In terms of safety, it is important to handle this compound with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory or agricultural settings. Overall, O-Bromophenoxyacetic acid is a significant compound in both chemical research and agricultural applications.
Formula:C8H7BrO3
InChI:InChI=1/C8H7BrO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11)
SMILES:c1ccc(c(c1)Br)OCC(=O)O
Synonyms:- Rarechem Al Bo 0893
- Aurora 6883
- Art-Chem-Bb B013825
- Asischem D38773
- Chembrdg-Bb 3013825
- Akos Bbs-00001062
- Akos B013825
- (2-Bromophenoxy)Acetic Acid
- 2-Bromophenoxyacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(2-bromophenoxy)-
CAS:Formula:C8H7BrO3Purity:98%Color and Shape:SolidMolecular weight:231.04342-(2-Bromophenoxy)acetic acid
CAS:2-(2-Bromophenoxy)acetic acidPurity:98%Molecular weight:231.04g/mol(2-Bromo-phenoxy)-acetic acid
CAS:Formula:C8H7BrO3Purity:98%Color and Shape:No data available.Molecular weight:231.045o-Bromophenoxyacetic acid
CAS:Controlled Product<p>Applications o-Bromophenoxyacetic acid<br></p>Formula:C8H7BrO3Color and Shape:NeatMolecular weight:231.04



