CAS 1879-58-9
:2-(3-Cyanophenoxy)acetic acid
Description:
2-(3-Cyanophenoxy)acetic acid, with the CAS number 1879-58-9, is an organic compound characterized by its unique structure, which includes a cyanophenyl group and an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. It exhibits properties typical of both aromatic compounds and carboxylic acids, including potential acidity and reactivity with bases. The cyanophenyl group contributes to its electronic properties, potentially influencing its reactivity and interactions in various chemical environments. This compound may be of interest in pharmaceutical research and agrochemical applications due to its potential biological activity. Additionally, its structural features may allow for various derivatizations, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c10-5-7-2-1-3-8(4-7)13-6-9(11)12/h1-4H,6H2,(H,11,12)
InChI key:InChIKey=UXBVJOUILGIGHW-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(C#N)=CC=C1
Synonyms:- (m-Cyanophenoxy)acetic acid
- 2-(3-Cyanophenoxy)Acetic Acid
- Acetic acid, (3-cyanophenoxy)-
- Acetic acid, (m-cyanophenoxy)-
- Acetic acid, 2-(3-cyanophenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(3-cyanophenoxy)-
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.15682-(3-Cyanophenoxy)acetic acid
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.159(3-Cyanophenoxy)acetic acid
CAS:(3-Cyanophenoxy)acetic acid is an analog of mandelic acid that has been shown to inhibit thrombus formation in vitro. The mechanism of action is not well understood, but it may involve the inhibition of phospholipase A2, which inhibits the production of prostaglandin E2 and thromboxane A2. It also inhibits platelet aggregation, the process by which platelets stick together and form clots that can block blood vessels. Furthermore, this compound has been shown to have antithrombotic effects in vivo in mice and rats. (3-Cyanophenoxy)acetic acid does not cause bleeding or increase the risk for bleeding.Formula:C9H7NO3Purity:Min. 95%Molecular weight:177.16 g/mol



