CAS 18794-84-8: β-Farnesene
Description:β-Farnesene is a naturally occurring sesquiterpene hydrocarbon, characterized by its molecular formula C15H24. It is a colorless to pale yellow liquid with a characteristic sweet, floral aroma, often associated with the scent of apples and other fruits. This compound is primarily found in essential oils of various plants, including certain species of mint and in the peel of fruits like apples. β-Farnesene is known for its role in plant defense mechanisms, acting as an attractant for pollinators and a repellent for herbivores. Additionally, it has applications in the fragrance and flavor industry due to its pleasant scent. In terms of chemical properties, β-Farnesene is relatively stable under normal conditions but can undergo oxidation and polymerization reactions. Its structure features a long carbon chain with multiple double bonds, contributing to its reactivity and interactions with other chemical species. Overall, β-Farnesene is significant both ecologically and industrially, making it a compound of interest in various fields, including agriculture and perfumery.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+
InChI key:InChIKey=JSNRRGGBADWTMC-NTCAYCPXSA-N
SMILES:C=CC(=C)CCC=C(C)CCC=C(C)C
- Synonyms:
- (6E)-7,11-Dimethyl-3-methylene-1,6,10-dodecatriene
- (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene
- (E)-7,11-Dimethyl-3-methylendodeca-1,6,10-trien
- (E)-7,11-Dimethyl-3-methylendodeca-1,6,10-triene
- (E)-7,11-Dimethyl-3-methylene-1,6,10-dodecatriene
- (E)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene
- (E)-7,11-dimetil-3-metilendodeca-1,6,10-trieno
- (E)-β-Farnesene
- 1,6,10-Dodecatriene, 7,11-dimethyl-3-methylene-, (6E)-
- 1,6,10-Dodecatriene, 7,11-dimethyl-3-methylene-, (E)-
- See more synonyms
- 7,11-Dimethyl-3-methylene-1,6,10-dodecatriene
- Biofene
- Dodeca-1,6,10-Triene, 7,11-Dimethyl-3-Methylene-, (E)-
- FARNESENE, β-
- Ho wood oil/ Linalool
- trans-β-Farnesene
- β-Farnesene
- γ-FARNESENE
