CAS 187949-86-6
:3-Amino-5-(4-chlorophenyl)thiophene-2-carboxylic acid
Description:
3-Amino-5-(4-chlorophenyl)thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base, thus exhibiting amphoteric behavior. The presence of a 4-chlorophenyl substituent enhances its lipophilicity and may influence its biological activity. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. Its specific properties, such as solubility, melting point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications, particularly in the development of therapeutic agents. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C11H8ClNO2S
InChI:InChI=1/C11H8ClNO2S/c12-7-3-1-6(2-4-7)9-5-8(13)10(16-9)11(14)15/h1-5H,13H2,(H,14,15)
SMILES:c1cc(ccc1c1cc(c(C(=O)O)s1)N)Cl
Synonyms:- 2-Thiophenecarboxylic Acid, 3-Amino-5-(4-Chlorophenyl)-
- 3-Amino-5-(4-chlorophenyl)thiophene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Amino-5-(4-chlorophenyl)thiophene-2-carboxylic acid
CAS:Formula:C11H8ClNO2SColor and Shape:SolidMolecular weight:253.7047
