CAS 187963-91-3: (3-bromophenyl)(thiophen-3-yl)methanone
Description:(3-bromophenyl)(thiophen-3-yl)methanone, with the CAS number 187963-91-3, is an organic compound characterized by the presence of a bromophenyl group and a thiophene moiety attached to a ketone functional group. This compound typically exhibits a molecular structure that includes a carbonyl group (C=O) linked to a methylene bridge connecting the two aromatic systems. The bromine substituent on the phenyl ring can influence the compound's reactivity and physical properties, such as its solubility and electronic characteristics. The thiophene ring contributes to the compound's aromaticity and can enhance its stability and potential for participating in various chemical reactions, including electrophilic substitutions. Additionally, the presence of both aromatic systems may impart interesting optical properties, making it a candidate for applications in organic electronics or as a building block in synthetic organic chemistry. Overall, this compound's unique structural features suggest potential utility in various chemical and material science applications.
Formula:C11H7BrOS
InChI:InChI=1/C11H7BrOS/c12-10-3-1-2-8(6-10)11(13)9-4-5-14-7-9/h1-7H
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Methanone, (3-bromophenyl)-3-thienyl- REF: IN-DA002GL1CAS: 187963-91-3 | - - - | To inquire | Tue 15 Apr 25 |
 | 3-(3-Bromobenzoyl)thiophene REF: 10-F202326CAS: 187963-91-3 | 97.0% | - - - | Discontinued product |
 | 3-(3-Bromobenzoyl)thiophene REF: 3D-MHA96391CAS: 187963-91-3 | Min. 95% | - - - | Discontinued product |
Ref: 10-F202326
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information |
3-(3-Bromobenzoyl)thiophene
Ref: 3D-MHA96391
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
