CAS 18797-86-9: Cinchonan-9-ol, 6′-methoxy-, acetate, (8α,9R)-

Description:Cinchonan-9-ol, 6′-methoxy-, acetate, (8α,9R)- is a chemical compound belonging to the class of alkaloids, specifically derived from the cinchona tree, which is known for its medicinal properties. This compound features a complex bicyclic structure typical of cinchona alkaloids, characterized by a quinoline ring system. The presence of a methoxy group at the 6′ position and an acetate group contributes to its unique chemical reactivity and potential biological activity. It is stereochemically defined with specific configurations at the 8α and 9R positions, which can influence its pharmacological properties. Cinchonan-9-ol derivatives are often studied for their potential use in treating various ailments, including malaria, due to their antimalarial properties. The compound's solubility, stability, and interaction with biological targets are influenced by its functional groups and stereochemistry. As with many alkaloids, it may exhibit a range of effects on biological systems, making it a subject of interest in medicinal chemistry and pharmacology.

Formula:C₂₂H₂₆N₂O₃

InChI:InChI=1S/C22H26N2O3/c1-4-15-13-24-10-8-16(15)11-21(24)22(27-14(2)25)18-7-9-23-20-6-5-17(26-3)12-19(18)20/h4-7,9,12,15-16,21-22H,1,8,10-11,13H2,2-3H3/t15-,16-,21-,22+/m0/s1

InChI key:InChIKey=LBXIBQQYUBUMMK-WWLNLUSPSA-N

SMILES:O=C(OC(C=1C=CN=C2C=CC(OC)=CC21)C3N4CCC(C3)C(C=C)C4)C

Synonyms:
Quinine, acetate (ester)
Cinchonan-9-ol, 6′-methoxy-, acetate, (8α,9R)-
Quinine acetate
Cinchonan-9-ol, 6′-methoxy-, acetate (ester), (8α,9R)-
O-Acetylquinine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Cinchonan-9-ol, 6'-methoxy-, acetate, (8α,9R)- REF: IN-DA002GMACAS: 18797-86-9	97%	59.00 €~198.00 €	Fri 28 Mar 25
(R)-(6-Methoxyquinolin-4-yl)((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methyl acetate REF: 10-F869702CAS: 18797-86-9	97% mix TBC as stabilizer	95.00 €~202.00 €	Mon 31 Mar 25
Quinine acetate REF: 3D-TAA79786CAS: 18797-86-9	Min. 95%	- - -	Discontinued product