CAS 187970-01-0

[3-(2-pyridyl)-1,2,4-oxadiazol-5-yl]methanol

Description:

[3-(2-pyridyl)-1,2,4-oxadiazol-5-yl]methanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the oxadiazole ring contributes to its potential as a bioactive molecule, often exhibiting interesting pharmacological properties. This compound is typically a solid at room temperature and may be soluble in polar organic solvents, which is common for compounds containing heteroatoms like nitrogen and oxygen. Its functional groups, particularly the hydroxymethyl group, can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals. Additionally, the presence of the pyridine ring may enhance its ability to interact with biological systems, making it a subject of interest in various research fields, including drug discovery and materials science. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₈H₇N₃O₂

InChI: InChI=1/C8H7N3O2/c12-5-7-10-8(11-13-7)6-3-1-2-4-9-6/h1-4,12H,5H2

SMILES: c1ccnc(c1)c1nc(CO)on1

Synonyms:

• [3-(Pyridin-2-Yl)-1,2,4-Oxadiazol-5-Yl]Methanol
• 1,2,4-Oxadiazole-5-Methanol, 3-(2-Pyridinyl)-

[3-(2-pyridinyl)-1,2,4-oxadiazol-5-yl]methanol

CAS: 187970-01-0

Formula: C₈H₇N₃O₂

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 177.163

Ref: 10-F311794