CAS 187978-79-6

5-(3-Methylphenyl)-2,4-imidazolidinedione

Description:

5-(3-Methylphenyl)-2,4-imidazolidinedione, identified by its CAS number 187978-79-6, is a chemical compound that belongs to the class of imidazolidinediones. This substance features a five-membered ring structure containing two nitrogen atoms and is characterized by the presence of a 3-methylphenyl group, which contributes to its unique properties. The compound typically exhibits solid-state characteristics at room temperature and may have specific solubility profiles in various solvents, often being more soluble in organic solvents than in water. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting metabolic or neurological conditions. The imidazolidinedione framework is known for its biological activity, and derivatives of this compound may exhibit various pharmacological effects. As with many organic compounds, safety data and handling precautions should be considered, as the compound may have specific toxicity or reactivity profiles that necessitate careful management in laboratory or industrial settings.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-6-3-2-4-7(5-6)8-9(13)12-10(14)11-8/h2-5,8H,1H3,(H2,11,12,13,14)

InChI key: InChIKey=QQFXJIUQTZJJHI-UHFFFAOYSA-N

SMILES: O=C1C(C2=CC(C)=CC=C2)NC(=O)N1

Synonyms:

• 5-(3-Methylphenyl)-2,4-imidazolidinedione
• 2,4-Imidazolidinedione, 5-(3-methylphenyl)-

5-(3-Methylphenyl)imidazolidine-2,4-dione

Controlled Product

CAS: 187978-79-6

Applications 5-(3-methylphenyl)imidazolidine-2,4-dione (cas# 187978-79-6) is a useful research chemical.

Formula: C₁₀H₁₀N₂O₂

Color and Shape: Neat

Molecular weight: 190.2

Ref: TR-M259756