CAS 187980-99-0
:N-(2,3-Dimethylbenzoyl)glycine
Description:
N-(2,3-Dimethylbenzoyl)glycine, with the CAS number 187980-99-0, is an organic compound that features a glycine moiety linked to a 2,3-dimethylbenzoyl group. This compound is characterized by its structural components, which include an amine group (-NH2), a carboxylic acid group (-COOH), and an aromatic ring with two methyl substituents. The presence of the benzoyl group contributes to its potential as a photoinitiator in polymerization processes, particularly in UV-curable systems. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. N-(2,3-Dimethylbenzoyl)glycine may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its stability under various conditions and its ability to form derivatives can be explored for applications in materials science and organic synthesis. Overall, this compound represents a versatile building block in organic chemistry with potential applications across multiple fields.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-7-4-3-5-9(8(7)2)11(15)12-6-10(13)14/h3-5H,6H2,1-2H3,(H,12,15)(H,13,14)
InChI key:InChIKey=MTDMPTIWIYCVAL-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)(=O)C1=C(C)C(C)=CC=C1
Synonyms:- 2,3-Dimethylhippuric acid
- Glycine, N-(2,3-dimethylbenzoyl)-
- 2-[(2,3-Dimethylphenyl)formamido]acetic acid
- 2-[(2,3-Dimethylbenzoyl)amino]acetic acid
- N-(2,3-Dimethylbenzoyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
