CAS 188-52-3: (5)HELICENE
Description:Helicene, with the CAS number 188-52-3, is a polycyclic aromatic hydrocarbon characterized by its unique helical structure formed by the fusion of multiple aromatic rings. This compound exhibits a distinctive chiral nature, resulting in two enantiomers that can be distinguished by their optical activity. Helicene is known for its interesting electronic properties, including strong fluorescence and potential applications in organic electronics and materials science. Its helical shape contributes to its ability to interact with light, making it a subject of interest in photonics and chiral recognition studies. Additionally, helicene's stability and reactivity can vary depending on the substituents attached to its aromatic rings, influencing its chemical behavior and potential uses in various fields, including medicinal chemistry and nanotechnology. Overall, helicene serves as a fascinating example of how molecular geometry can impact the physical and chemical properties of a substance.
Formula:C22H14
InChI:InChI=1/C22H14/c1-3-7-19-15(5-1)9-11-17-13-14-18-12-10-16-6-2-4-8-20(16)22(18)21(17)19/h1-14H
- Synonyms:
- pentahelicene
- DIBENZO(C,G)PHENANTHRENE
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [5]Helicene REF: 3B-H1892CAS: 188-52-3 | >95.0%(HPLC) | 264.00 € | Thu 10 Apr 25 |
![]() | Dibenzo[c,g]phenanthrene REF: IN-DA002GMXCAS: 188-52-3 | 95.0% | To inquire | Thu 17 Apr 25 |
![]() | (5)Helicene REF: 3D-AAA18852CAS: 188-52-3 | Min. 95% | - - - | Discontinued product |

[5]Helicene
Ref: 3B-H1892
100mg | 264.00 € |

Ref: IN-DA002GMX
Undefined size | To inquire |

(5)Helicene
Ref: 3D-AAA18852
Undefined size | Discontinued | Request information |