CAS 18800-37-8
:1-(2-BROMOETHOXY)-2-NITROBENZENE
Description:
1-(2-Bromoethoxy)-2-nitrobenzene, with the CAS number 18800-37-8, is an organic compound characterized by the presence of a nitro group and a bromoethoxy substituent on a benzene ring. This compound features a nitro group (-NO2) attached to the second position of the benzene ring, which is known for its electron-withdrawing properties, influencing the reactivity of the molecule. The bromoethoxy group, consisting of a bromine atom and an ethoxy group (-O-CH2-CH3), is located at the first position of the benzene ring, contributing to the compound's overall polarity and potential for nucleophilic substitution reactions. The presence of bromine enhances the compound's reactivity, making it useful in various synthetic applications, including the preparation of more complex organic molecules. Additionally, the compound's physical properties, such as solubility and boiling point, are influenced by the functional groups present, which can affect its behavior in different chemical environments. Overall, 1-(2-Bromoethoxy)-2-nitrobenzene is a valuable intermediate in organic synthesis and materials science.
Formula:C8H8BrNO3
InChI:InChI=1/C8H8BrNO3/c9-5-6-13-8-4-2-1-3-7(8)10(11)12/h1-4H,5-6H2
SMILES:c1ccc(c(c1)N(=O)=O)OCCBr
Synonyms:- 2-(2-Nitrophenoxy)ethyl bromide
- 2-Nitrophenoxyethylbromide
- 1-(4-Bromoethoxy)-2-nitrobenzene
- 1-(2-Bromoethoxy)-2-nitrobenzene 98%
- 1-(2-BROMOETHOXY)-2-NITROBENZENE
- 1-(2-Bromoethoxy)-2-nitrobenzene,99%
- 1-(2-Bromoethoxy)-2-nitrobenzene98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzene, 1-(2-bromoethoxy)-2-nitro-
CAS:Formula:C8H8BrNO3Purity:98%Color and Shape:SolidMolecular weight:246.05801-(2-Bromoethoxy)-2-nitrobenzene
CAS:1-(2-Bromoethoxy)-2-nitrobenzenePurity:98%Molecular weight:246.06g/mol1-(2-Bromoethoxy)-2-nitrobenzene
CAS:Formula:C8H8BrNO3Purity:98%Color and Shape:SolidMolecular weight:246.061-(2-Bromoethoxy)-2-nitrobenzene
CAS:1-(2-Bromoethoxy)-2-nitrobenzene is a fluorescent ionophore that is used in the production of high-performance liquid chromatography (HPLC) columns. This chemical is synthesized by a stepwise reaction that starts with the formation of an acetonitrile adduct. The acetonitrile group is then removed and replaced with an ethoxy group to form the final product. The synthetic procedure for 1-(2-bromoethoxy)-2-nitrobenzene has been rationalized and it can be recycled using magnesium as a reducing agent. In addition, this chemical has been shown to bind to sensor proteins due to its high affinity for them.Formula:C8H8BrNO3Purity:Min. 95%Molecular weight:246.06 g/mol



