CAS 18800-74-3
:na-T-boc-L-isoglutamine
Description:
Na-T-Boc-L-isoglutamine is a derivative of isoglutamine, an amino acid that plays a role in protein synthesis and metabolism. The "T-Boc" (tert-butyloxycarbonyl) group is a common protecting group used in peptide synthesis, which helps to prevent unwanted reactions during the synthesis process. This compound is typically utilized in the field of organic chemistry and biochemistry for the synthesis of peptides and other complex molecules. It is characterized by its stability under standard laboratory conditions, solubility in organic solvents, and reactivity that allows for further functionalization. The sodium salt form indicates that it is likely soluble in water, making it suitable for various biochemical applications. As with many amino acid derivatives, it may exhibit specific optical activity due to its chiral nature. Safety precautions should be taken when handling this compound, as with all chemicals, to avoid potential hazards.
Formula:C10H17N2O5
InChI:InChI=1/C10H18N2O5/c1-10(2,3)17-9(16)12-6(8(11)15)4-5-7(13)14/h6H,4-5H2,1-3H3,(H2,11,15)(H,12,16)(H,13,14)/p-1/t6-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CCC(=O)[O-])C(=N)O)O
Synonyms:- Boc-Glu-NH2
- N~2~-(tert-butoxycarbonyl)-L-alpha-glutamine
- N~2~-(tert-butoxycarbonyl)-5-oxido-5-oxo-L-norvalinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Boc-amino)-4-carbamoylbutyric acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H18N2O5Purity:98%Molecular weight:246.26Pentanoic acid, 5-amino-4-[[(1,1-dimethylethoxy)carbonyl]amino]-5-oxo-, (4S)-
CAS:Formula:C10H18N2O5Purity:98%Color and Shape:SolidMolecular weight:246.2603Boc-Glu-NH2
CAS:<p>M03286 - Boc-Glu-NH2</p>Formula:C10H18N2O5Purity:98%Color and Shape:SolidMolecular weight:246.263





