CAS 18807-74-4
:N-Z-1,5-diaminopentane hydrochloride
Description:
N-Z-1,5-diaminopentane hydrochloride, also known as 1,5-diaminopentane hydrochloride, is an organic compound characterized by its amine functional groups. It is a hydrochloride salt of 1,5-diaminopentane, which is a straight-chain aliphatic diamine. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the amine groups, which can engage in hydrogen bonding. The presence of two amino groups allows for potential reactivity in various chemical reactions, including those involving amine functionalities, such as acylation or alkylation. It is often used in biochemical applications, including as a building block in the synthesis of polymers, pharmaceuticals, and other organic compounds. Safety data sheets indicate that it should be handled with care, as with many amines, due to potential irritant properties. Proper storage conditions involve keeping it in a cool, dry place, away from incompatible substances.
Formula:C13H21ClN2O2
InChI:InChI=1/C13H20N2O2.ClH/c14-9-5-2-6-10-15-13(16)17-11-12-7-3-1-4-8-12;/h1,3-4,7-8H,2,5-6,9-11,14H2,(H,15,16);1H
SMILES:c1ccc(cc1)COC(=NCCCCCN)O.Cl
Synonyms:- N-Carbobenzoxy-1,5-diaminopentane hydrochloride
- N-Z-1,5-pentanediamine hydrochloride
- benzyl N-(5-aminopentyl)carbamate hydrochloride
- N-Cbz-1,5-diaminopentane HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-Carbobenzoxy-1,5-diaminopentane Hydrochloride
CAS:Formula:C13H20N2O2·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:272.77Carbamic acid, N-(5-aminopentyl)-, phenylmethyl ester, hydrochloride (1:1)
CAS:Formula:C13H21ClN2O2Purity:98%Color and Shape:SolidMolecular weight:272.7710N-Carbobenzoxy-1,5-diaminopentane hydrochloride
CAS:N-Carbobenzoxy-1,5-diaminopentane hydrochloridePurity:98%Molecular weight:272.77g/molZ-1,5-Diaminopentane HCl
CAS:<p>Z-1,5-Diaminopentane HCl is a chemical intermediate used in the synthesis of pharmaceuticals and other organic compounds. It is also useful as a building block in the synthesis of complex compounds with high purity. Z-1,5-Diaminopentane HCl is soluble in water and has a boiling point of 232°C. CAS No. 18807-74-4</p>Formula:C13H20N2O2·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:272.77 g/mol




