CAS 1881-37-4
:(17β)-4-Fluoroestra-1,3,5(10)-triene-3,17-diol
Description:
(17β)-4-Fluoroestra-1,3,5(10)-triene-3,17-diol, commonly referred to as a synthetic estrogen, is a chemical compound characterized by its structural modifications to the natural estrogen backbone. It features a fluorine atom at the 4-position and hydroxyl groups at the 3 and 17 positions, which are critical for its biological activity. This compound exhibits high affinity for estrogen receptors, influencing various physiological processes, including reproductive functions and bone density regulation. Its unique triene structure contributes to its stability and potency as an estrogenic agent. The presence of the fluorine atom enhances its metabolic stability compared to natural estrogens, potentially leading to prolonged activity in biological systems. As a synthetic derivative, it is often studied for its therapeutic applications in hormone replacement therapy and its potential role in treating estrogen-related conditions. However, like many synthetic hormones, it may also carry risks of side effects, necessitating careful consideration in clinical use.
Formula:C18H23FO2
InChI:InChI=1S/C18H23FO2/c1-18-9-8-11-10-4-6-15(20)17(19)13(10)3-2-12(11)14(18)5-7-16(18)21/h4,6,11-12,14,16,20-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1
InChI key:InChIKey=QZFXMXJXAUMHQR-ZHIYBZGJSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=C(F)C(O)=CC4)(CC1)[H])[H])(CC[C@@H]2O)[H]
Synonyms:- (17-beta)-4-Fluoroestra-1,3,5(10)-triene-3,17-diol
- (17β)-4-Fluoroestra-1,3,5(10)-triene-3,17-diol
- 4-Fluoro-17β-estradiol
- 4-Fluoroestra-1,3,5(10)-Triene-3,17-Diol
- 4-Fluoroestra-1,3,5-(10)-triene-3,17-beta-diol
- Brn 2141327
- Estra-1,3,5(10)-triene-3,17-beta-diol, 4-fluoro-
- Estra-1,3,5(10)-triene-3,17-diol, 4-fluoro-, (17β)-
- Estra-1,3,5(10)-triene-3,17β-diol, 4-fluoro-
- Nsc 94528
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Fluoroestradiol
CAS:Controlled Product<p>4-Fluoroestradiol is an estrogen with a molecular weight of 270.4 g/mol that has been shown to be carcinogenic in animal models. 4-Fluoroestradiol binds to the estrogen receptor and activates the gene product, which stimulates cell growth and proliferation. This drug has been shown to induce cancer in tissues such as the liver, biliary tract, and mammary glands when administered at doses higher than 0.3 mg/kg/day. 4-Fluoroestradiol also interacts with hydrogen bonds in enzymes such as retinol dehydrogenase, all-trans-retinoic acid (ATRA), and specific agents such as retinoic acid (RA). This interaction may inhibit the catalytic rate of these enzymes or alter their substrate specificity.</p>Formula:C18H23FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:290.37 g/mol

