CAS 18810-25-8
:Odoroside H
Description:
Odoroside H, with the CAS number 18810-25-8, is a chemical compound known for its unique olfactory properties. It is classified as a glycoside, specifically a type of saponin, which contributes to its characteristic aroma. This compound is primarily derived from certain plant sources, particularly those in the family of flowering plants. Odoroside H is notable for its sweet, floral scent, making it of interest in the fragrance and flavor industries. Its structure typically includes a sugar moiety linked to a non-sugar component, which influences its solubility and interaction with biological systems. Additionally, Odoroside H may exhibit various biological activities, including potential antioxidant properties. However, its stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, Odoroside H represents a fascinating example of how natural compounds can be utilized in commercial applications, particularly in enhancing sensory experiences in products.
Formula:C30H46O8
InChI:InChI=1S/C30H46O8/c1-16-24(32)26(35-4)25(33)27(37-16)38-19-7-10-28(2)18(14-19)5-6-22-21(28)8-11-29(3)20(9-12-30(22,29)34)17-13-23(31)36-15-17/h13,16,18-22,24-27,32-34H,5-12,14-15H2,1-4H3/t16-,18-,19+,20-,21+,22-,24+,25-,26+,27+,28+,29-,30+/m1/s1
InChI key:InChIKey=VPUNMTHWNSJUOG-HYDVPRFCSA-N
SMILES:O[C@@]12[C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@@H](O[C@H]5[C@H](O)[C@@H](OC)[C@@H](O)[C@@H](C)O5)CC4)[H])(CC[C@]1(C)[C@H](CC2)C6=CC(=O)OC6)[H])[H]
Synonyms:- Digitoxigenin β-D-digitaloside
- (3β,5β)-3-[(6-Deoxy-3-O-methyl-β-D-galactopyranosyl)oxy]-14-hydroxycard-20(22)-enolide
- Card-20(22)-enolide, 3-[(6-deoxy-3-O-methyl-β-D-galactopyranosyl)oxy]-14-hydroxy-, (3β,5β)-
- Odoroside H
- Digitoxigenin digitaloside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Card-20(22)-enolide, 3-[(6-deoxy-3-O-methyl-β-D-galactopyranosyl)oxy]-14-hydroxy-, (3β,5β)-
CAS:Formula:C30H46O8Color and Shape:SolidMolecular weight:534.6814Odoroside H
CAS:Odoroside H has anticancer activities, the cytotoxic effects are induced by the inhibition of the plasma membrane bound Na(+)/K(+)-ATPase.Formula:C30H46O8Purity:98%Color and Shape:SolidMolecular weight:534.68Odoroside H
CAS:<p>Odoroside H is a cardiac glycoside, which is a type of compound well-known for its influence on cardiac tissues. It is derived from Nerium oleander, a plant recognized for its bioactive secondary metabolites. The mode of action involves inhibition of the Na⁺/K⁺-ATPase pump, leading to an increase in intracellular sodium concentration. This alteration promotes increased intracellular calcium levels via the sodium-calcium exchanger, ultimately enhancing cardiac contractility. Odoroside H's potent effects on cardiac muscle make it invaluable for research into heart disease mechanisms, particularly in exploring pathways affecting cardiac output and rhythm regulation. Due to its specificity and potency, Odoroside H is a crucial tool for scientists investigating the electrophysiological aspects and pharmacological modulation of cardiac function.</p>Formula:C30H46O8Purity:Min. 95%Molecular weight:534.7 g/mol



