CAS 188120-61-8
:4-(2,4-Dichloro-phenyl)-5- methyl-thiazol-2-ylamine
Description:
4-(2,4-Dichloro-phenyl)-5-methyl-thiazol-2-ylamine, with the CAS number 188120-61-8, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its potential biological activity and lipophilicity. The methyl group attached to the thiazole enhances its structural diversity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of halogens, such as chlorine, often influences the compound's reactivity and interaction with biological targets. Additionally, the thiazole moiety is known for its role in various biological activities, including antimicrobial and anticancer properties. As with many organic compounds, the specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups.
Formula:C10H8Cl2N2S
InChI:InChI=1/C10H8Cl2N2S/c1-5-9(14-10(13)15-5)7-3-2-6(11)4-8(7)12/h2-4H,1H3,(H2,13,14)
SMILES:Cc1c(c2ccc(cc2Cl)Cl)[nH]c(=N)s1
Synonyms:- 2-Thiazolamine, 4-(2,4-dichlorophenyl)-5-methyl-
- 4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine
- 4-(2,4-dichlorophenyl)-5-methyl-2-thiazolamine
- 4-(2,4-dichlorophenyl)-5-methyl-thiazol-2-amine
- 4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine(SALTDATA: FREE)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Thiazolamine, 4-(2,4-dichlorophenyl)-5-methyl-
CAS:Formula:C10H8Cl2N2SPurity:95%Color and Shape:SolidMolecular weight:259.15494-(2,4-Dichlorophenyl)-5-methylthiazol-2-amine
CAS:4-(2,4-Dichlorophenyl)-5-methylthiazol-2-aminePurity:95%Molecular weight:259.16g/mol4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine
CAS:4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine is a chemical that has been used as a reagent in organic synthesis and as an intermediate in the production of other compounds. It can be used to synthesize a wide variety of different compounds because it is a versatile building block with a wide range of functional groups. 4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine is also useful for the preparation of complex compounds. This chemical is usually obtained from commercial suppliers or as a byproduct during the synthesis of other chemicals.Formula:C10H8Cl2N2SPurity:Min. 95%Color and Shape:PowderMolecular weight:259.16 g/mol4-(2,4-Dichloro-phenyl)-5-methyl-thiazol-2-ylamine
CAS:Formula:C10H8Cl2N2SPurity:95.0%Molecular weight:259.15



