CAS 188121-31-5

6-Methyl-5-nitroisoquinoline

Description:

6-Methyl-5-nitroisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 6-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in organic solvents. Its molecular formula reflects the presence of nitrogen and oxygen in addition to carbon and hydrogen, indicating potential reactivity and interactions with other chemical species. The nitro group can participate in electrophilic substitution reactions, while the isoquinoline framework may engage in various chemical transformations, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, compounds like 6-Methyl-5-nitroisoquinoline may exhibit biological activity, which can be explored for potential pharmaceutical applications. Safety data should be consulted for handling and usage, as nitro compounds can pose health risks.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1S/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3

InChI key: InChIKey=YYPKZGWCMPOFRV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C2=C(C=CC1C)C=NC=C2

Synonyms:

• 6-Methyl-5-nitroisoquinoline
• Isoquinoline, 6-methyl-5-nitro-

Isoquinoline, 6-methyl-5-nitro-

CAS: 188121-31-5

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA002GPY

6-Methyl-5-nitroisoquinoline

CAS: 188121-31-5

6-Methyl-5-nitroisoquinoline

Purity: 95%

Molecular weight: 188.18g/mol

Ref: 54-OR921242

6-METHYL-5-NITROISOQUINOLINE

CAS: 188121-31-5

Formula: C₁₀H₈N₂O₂

Purity: 97%

Molecular weight: 188.186

Ref: 10-F468153

6-Methyl-5-nitroisoquinoline

CAS: 188121-31-5

6-Methyl-5-nitroisoquinoline is an organic compound with the formula C8H7N3O. It is a nitro derivative of isoquinoline and has been shown to have high selectivity for cyclopropanation reactions. The discovery of this compound was preceded by optimization of the reaction conditions, which led to the development of a scalable, efficient, and economical synthesis.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.19 g/mol

Ref: 3D-NHA12131