CAS 188125-86-2

1,3-dichloropropan-2-one O-benzyloxime

Description:

1,3-Dichloropropan-2-one O-benzyloxime is an organic compound characterized by its functional groups, including a ketone and an oxime. It features a three-carbon chain with two chlorine atoms attached to the first and third carbons, while the second carbon is bonded to a benzyloxime group. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of the oxime functional group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the dichloro substituents may influence its reactivity and interactions with other chemical species. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₁₀H₁₁Cl₂NO

InChI: InChI=1/C10H11Cl2NO/c11-6-10(7-12)13-14-8-9-4-2-1-3-5-9/h1-5H,6-8H2

SMILES: c1ccc(cc1)CON=C(CCl)CCl

1,3-Dichloropropan-2-one O-Benzyl-oxime

Controlled Product

CAS: 188125-86-2

Applications 1,3-Dichloropropan-2-one O-Benzyl-oxime (cas# 188125-86-2) is a compound useful in organic synthesis.

Formula: C₁₀H₁₁Cl₂NO

Color and Shape: Neat

Molecular weight: 232.11

Ref: TR-D435758