CymitQuimica logo

CAS 1881321-98-7

:

1-Chloro-4-ethoxy-2-(trifluoromethyl)benzene

Description:
1-Chloro-4-ethoxy-2-(trifluoromethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group, an ethoxy group, and a trifluoromethyl group. The presence of the chloro group introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The ethoxy group contributes to the compound's overall hydrophobic character while also providing potential sites for further chemical reactions. The trifluoromethyl group is known for enhancing the lipophilicity and stability of the compound, as well as imparting unique electronic properties. This compound may exhibit interesting biological activities and can be utilized in various applications, including pharmaceuticals and agrochemicals. Its synthesis typically involves electrophilic aromatic substitution reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C9H8ClF3O
InChI:InChI=1S/C9H8ClF3O/c1-2-14-6-3-4-8(10)7(5-6)9(11,12)13/h3-5H,2H2,1H3
InChI key:InChIKey=NOMRVFNQPUIWRA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(OCC)=CC=C1Cl
Synonyms:
  • 1-Chloro-4-ethoxy-2-(trifluoromethyl)benzene
  • Benzene, 1-chloro-4-ethoxy-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.