CAS 1881322-03-7

1H,5H-Benzo[ij]quinolizin-5-one, 6-(aminomethyl)-2,3-dihydro-, hydrochloride (1:1)

Description:

1H,5H-Benzo[ij]quinolizin-5-one, 6-(aminomethyl)-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which incorporates both a quinolizine and a benzene moiety. This compound features an aminomethyl group that contributes to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound's unique arrangement of atoms may impart specific optical and electronic properties, which could be relevant in the development of materials or in the study of its interactions with other chemical species. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₃H₁₄N₂O·ClH

InChI: InChI=1S/C13H14N2O.ClH/c14-8-11-7-10-4-1-3-9-5-2-6-15(12(9)10)13(11)16;/h1,3-4,7H,2,5-6,8,14H2;1H

InChI key: InChIKey=BYYPCYIRGFFTTI-UHFFFAOYSA-N

SMILES: O=C1N2C3=C(C=C1CN)C=CC=C3CCC2.Cl

Synonyms:

• 1H,5H-Benzo[ij]quinolizin-5-one, 6-(aminomethyl)-2,3-dihydro-, hydrochloride (1:1)

6-(aminomethyl)-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinolin-5-one hydrochloride

CAS: 1881322-03-7

Purity: 95.0%

Molecular weight: 250.72999572753906

Ref: 10-F512092