CAS 18819-89-1
:tetrabutylammonium benzoate,electro-chemical grade
Description:
Tetrabutylammonium benzoate, with the CAS number 18819-89-1, is an organic compound that serves as a quaternary ammonium salt. It is characterized by its tetrabutylammonium cation, which consists of four butyl groups attached to a nitrogen atom, and the benzoate anion derived from benzoic acid. This compound is typically used in electrochemical applications due to its ability to enhance the solubility of various ionic species in organic solvents, making it valuable in electrochemical studies and processes. It is known for its relatively high thermal stability and low volatility, which contribute to its effectiveness in various chemical environments. Tetrabutylammonium benzoate is also recognized for its role as a phase transfer catalyst, facilitating the transfer of ions across different phases. Safety considerations include handling it with care, as with many organic salts, to avoid skin and eye irritation. Overall, its unique properties make it a useful reagent in both research and industrial applications.
Formula:C14H20O10
InChI:InChI=1/C14H20O10/c1-6(15)20-5-10-12(21-7(2)16)13(22-8(3)17)11(19)14(24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12-,13-,14-/m1/s1
Synonyms:- Tetrabutylammonium benzoate
- 1,3,4,6-tetra-O-acetyl-beta-D-mannopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Butanaminium, N,N,N-tributyl-, benzoate (1:1)
CAS:Formula:C23H41NO2Purity:98%Color and Shape:SolidMolecular weight:363.5771Tetrabutylammonium benzoate
CAS:Tetrabutylammonium benzoate (TBAB) is a benzoate that has a fluorescence property. It is used in radiation therapy, as it absorbs ultraviolet light and emits light at a different wavelength. TBAB's reactivity is due to its amide group and inorganic acid functional groups. TBAB can be used to produce patterns with carbohydrate chemistry, which can provide information about the reactive site of the molecule. TBAB also reacts with aliphatic hydrocarbons and nitrogen atoms, which may be part of the cancer-fighting mechanism of this drug.Formula:C23H41NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:363.6 g/mol



