CAS 188198-38-1

2H-1-Benzopyran-4-amine,3,4-dihydro-,(4S)-(9CI)

Description:

2H-1-Benzopyran-4-amine, 3,4-dihydro-, (4S)-(9CI) is a chemical compound characterized by its bicyclic structure, which includes a benzopyran moiety and an amine functional group. This compound is part of the larger class of flavonoids, known for their diverse biological activities. The presence of the amine group suggests potential for hydrogen bonding and reactivity, which may contribute to its pharmacological properties. The stereochemistry indicated by the (4S) designation implies a specific spatial arrangement of atoms, which can influence the compound's interactions with biological targets. This compound may exhibit properties such as antioxidant activity, anti-inflammatory effects, or potential use in medicinal chemistry. Its CAS number, 188198-38-1, serves as a unique identifier for regulatory and research purposes. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its biological effects and potential applications in various fields.

Formula: C₉H₁₁NO

InChI: InChI=1/C9H11NO/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8H,5-6,10H2/t8-/m0/s1

SMILES: c1ccc2c(c1)[C@H](CCO2)N

Synonyms:

• (4S)-3,4-Dihydro-2H-chromen-4-amin
• (4S)-Chroman-4-amine
• 2H-1-benzopyran-4-amine, 3,4-dihydro-, (4S)-
• (4S)-3,4-dihydro-2H-chromen-4-amine

2H-1-Benzopyran-4-amine, 3,4-dihydro-, (4S)-

CAS: 188198-38-1

Formula: C₉H₁₁NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 149.1897

Ref: IN-DA002GRA

(4S)-3,4-Dihydro-2H-chromen-4-amine

CAS: 188198-38-1

(4S)-3,4-Dihydro-2H-chromen-4-amine

Purity: 97%

Molecular weight: 149.19g/mol

Ref: 54-OR81982

(S)-Chroman-4-amine

CAS: 188198-38-1

Formula: C₉H₁₁NO

Purity: 95%

Molecular weight: 149.193

Ref: 10-F217111