CAS 18822-86-1

dl-octanoyl carnitine chloride

Description:

DL-octanoyl carnitine chloride is a quaternary ammonium compound that plays a significant role in lipid metabolism and energy production within cells. It is a derivative of carnitine, which is essential for the transport of fatty acids into the mitochondria for β-oxidation. This compound is characterized by its ability to enhance fatty acid utilization, making it of interest in metabolic studies and potential therapeutic applications. It typically appears as a white to off-white crystalline powder and is soluble in water, which facilitates its use in various biological and pharmaceutical contexts. The chloride ion associated with the compound contributes to its stability and solubility. In research, DL-octanoyl carnitine chloride has been investigated for its effects on energy metabolism, weight management, and potential benefits in conditions related to metabolic disorders. As with many chemical substances, proper handling and safety precautions are essential due to its biological activity and potential effects on human health.

Formula: C₁₅H₃₀ClNO₄

InChI: InChI=1/C15H29NO4.ClH/c1-5-6-7-8-9-10-15(19)20-13(11-14(17)18)12-16(2,3)4;/h13H,5-12H2,1-4H3;1H

SMILES: CCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.Cl

Synonyms:

• 3-carboxy-N,N,N-trimethyl-2-(octanoyloxy)propan-1-aminium chloride
• dl-octanoyl carnitine chloride
• (+/-)-Octanoylcarnitinechloride
• (+/-)-OCTANOYLCARNITINE CHLORIDE
• (+/-)-Octanoylcarnit

(±)-Octanoylcarnitine chloride

CAS: 18822-86-1

(±)-Octanoylcarnitine chloride is a homolog of acetylcarnitine chloride.

Formula: C₁₅H₃₀ClNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 323.86

Ref: TM-T22483

(±)-Octanoylcarnitine Chloride

Controlled Product

CAS: 18822-86-1

Formula: C₁₅H₃₀NO₄•Cl

Color and Shape: Neat

Molecular weight: 288.40 + 35.45

Ref: TR-O239763