CAS 18829-70-4
:(-)-Catechol
Description:
(-)-Catechol, also known as 1,2-dihydroxybenzene, is an aromatic organic compound characterized by the presence of two hydroxyl groups (-OH) attached to a benzene ring. It is a colorless to pale yellow liquid with a sweet, aromatic odor and is soluble in water, alcohol, and ether. The compound exhibits a melting point around room temperature and has a boiling point that varies depending on atmospheric pressure. (-)-Catechol is known for its antioxidant properties and is used in various applications, including as a precursor in the synthesis of pharmaceuticals, agrochemicals, and dyes. It also plays a role in the production of certain polymers and resins. The compound can undergo oxidation to form quinones and is sensitive to light and air, which can lead to its degradation. In terms of safety, (-)-Catechol can be irritating to the skin and eyes, and appropriate precautions should be taken when handling it in laboratory or industrial settings.
Formula:C15H14O6
InChI:InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m1/s1
InChI key:InChIKey=PFTAWBLQPZVEMU-HIFRSBDPSA-N
SMILES:O[C@H]1[C@@H](OC=2C(C1)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3
Synonyms:- (-)-(2S,3R)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol
- (-)-(2S,3R)-Catechin
- (-)-Catechol
- (2S,3R)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol
- (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol
- (2S,3R)-2-(3,4-dihydroxyphenyl)chromane-3,5,7-triol
- (2S,3R)-Ent-catechin
- (2S-trans)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol
- 1H-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2S,3R)-
- 2H-1-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2S,3R)-
- 2H-1-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2S-trans)-
- <span class="text-smallcaps">L</span>-Catechin
- Catechin l-form
- Catechin, alpha
- Nsc 81746
- ent-Catechin
- l-Catechin
- l-Catechol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2H-1-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2S,3R)-
CAS:Formula:C15H14O6Purity:98%Color and Shape:SolidMolecular weight:290.2681(-)-catechin
CAS:Oxygen-heterocyclic compoundFormula:C15H14O6Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:290.27(-)-Catechin
CAS:(-)-Catechin ((-)-Cianidanol), an isomer of catechin, inhibits cyclooxygenase-1 (COX-1) with an IC50 of 1.4 μM.
Formula:C15H14O6Purity:98.06%Color and Shape:Solid PowderMolecular weight:290.27(-)-Catechin
CAS:(-)-Catechin is a flavonoid compound, classified as a polyphenolic antioxidant, which is predominantly derived from plant sources such as tea leaves, cocoa, and various fruits. Its molecular structure allows it to scavenge free radicals and chelate metal ions, exhibiting potent antioxidant properties. This reactive nature contributes to its ability to modulate signaling pathways and inhibit enzymatic activities related to oxidative stress and inflammation.
Formula:C15H14O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:290.27 g/mol






