CAS 1883284-94-3: 1-Naphthalenyl 1-[(4-fluorophenyl)methyl]-1H-indole-3-carboxylate

Description:1-Naphthalenyl 1-[(4-fluorophenyl)methyl]-1H-indole-3-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety, an indole ring, and a carboxylate functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions. The presence of the fluorophenyl group may influence its electronic properties, potentially enhancing lipophilicity and affecting its reactivity. The carboxylate group can participate in hydrogen bonding and may influence solubility in polar solvents. Additionally, compounds of this nature are often investigated for their biological activities, including potential pharmacological effects, due to the presence of the indole structure, which is common in many biologically active molecules. Overall, the characteristics of this compound suggest it may have applications in medicinal chemistry or materials science, although specific biological or physical properties would require empirical investigation.

Formula:C₂₆H₁₈FNO₂

InChI:InChI=1S/C26H18FNO2/c27-20-14-12-18(13-15-20)16-28-17-23(22-9-3-4-10-24(22)28)26(29)30-25-11-5-7-19-6-1-2-8-21(19)25/h1-15,17H,16H2

InChI key:InChIKey=RCEKSVIFQKKFLS-UHFFFAOYSA-N

SMILES:O=C(OC1=CC=CC=2C=CC=CC12)C3=CN(C=4C=CC=CC34)CC5=CC=C(F)C=C5