CAS 188347-48-0

3,5-Dibromobenzyl cyanide

Description:

3,5-Dibromobenzyl cyanide is an organic compound characterized by its structure, which includes a benzene ring substituted with two bromine atoms at the 3 and 5 positions and a cyanide group attached to a benzyl moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of bromine atoms contributes to its reactivity, making it useful in electrophilic substitution reactions. The cyanide group, known for its toxicity, also imparts significant chemical properties, including the ability to participate in nucleophilic reactions. Safety precautions are essential when handling this compound due to its hazardous nature. Additionally, 3,5-Dibromobenzyl cyanide may exhibit specific solubility characteristics depending on the solvent, and its stability can be influenced by environmental conditions. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.

Formula: C₈H₅Br₂N

InChI: InChI=1/C8H5Br2N/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5H,1H2

SMILES: C(C#N)c1cc(cc(c1)Br)Br

Synonyms:

• (3,5-Dibromophenyl)acetonitrile
• Benzeneacetonitrile, 3,5-Dibromo-
• 3,5-Dibromobenzeneacetonitrile

Benzeneacetonitrile, 3,5-dibromo-

CAS: 188347-48-0

Formula: C₈H₅Br₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 274.9400

Ref: IN-DA002GUA

2-(3,5-Dibromophenyl)acetonitrile

CAS: 188347-48-0

2-(3,5-Dibromophenyl)acetonitrile

Purity: 99%

Molecular weight: 274.94g/mol

Ref: 54-OR90306

3,5-Dibromobenzylcyanide

CAS: 188347-48-0

Formula: C₈H₅Br₂N

Purity: 95%

Color and Shape: No data available.

Molecular weight: 274.943

Ref: 10-F221952