CAS 18839-88-8
:AC-GLN-NH2
Description:
AC-GLN-NH2, also known as Acetyl-L-glutamine, is a derivative of the amino acid glutamine, characterized by the presence of an acetyl group attached to the nitrogen of the amine. This modification enhances its stability and solubility compared to free glutamine. The substance is typically a white to off-white crystalline powder and is soluble in water, making it suitable for various applications in biochemistry and nutrition. Acetyl-L-glutamine plays a role in cellular metabolism and is often studied for its potential benefits in supporting gut health, immune function, and muscle recovery. It is also utilized in research settings to investigate its effects on neurotransmission and as a precursor for the synthesis of other biomolecules. As with many amino acid derivatives, it is important to handle AC-GLN-NH2 with care, following appropriate safety guidelines, as it may have specific storage and stability requirements.
Formula:C7H13N3O3
InChI:InChI=1/C7H13N3O3/c1-4(11)10-5(7(9)13)2-3-6(8)12/h5H,2-3H2,1H3,(H2,8,12)(H2,9,13)(H,10,11)/t5-/m0/s1
SMILES:CC(=N[C@@H](CCC(=N)O)C(=N)O)O
Synonyms:- N-Alpha-Acetyl-Glutamine Amide
- Acetyl-L-Glutamine Acid
- Acetyl-L-Glutamine Amide
- Ac-Glutamine-Nh2
- N~2~-acetyl-L-glutamamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ac-Gln-NH2
CAS:Ac-Gln-NH2 is a multifunctional protein that has been covalently immobilized on the surface of a glass fiber. It can be used to immobilize enzymes and other proteins, as well as being able to function as an enzyme itself. Ac-Gln-NH2 has been shown to conjugate with various molecules, including antibodies, DNA, and proteins. The immobilizing process involves cross-linking the protein to the glass surface through a chemical method that uses reagents such as glutaraldehyde or epoxy resin. Immobilization of Ac-Gln-NH2 onto a glass surface allows for easier use in applications such as diagnostics and industrial processes.
Formula:C7H13N3O3Purity:Min. 95%Molecular weight:187.2 g/mol


