CAS 18840-45-4
:penicillamine cysteine disulfide
Description:
Penicillamine cysteine disulfide, with the CAS number 18840-45-4, is a chemical compound that serves as a derivative of penicillamine, an amino acid that contains a thiol group. This compound is characterized by its ability to form disulfide bonds, which are crucial in stabilizing protein structures and influencing biochemical pathways. It is typically utilized in medicinal chemistry, particularly in the treatment of conditions such as rheumatoid arthritis and heavy metal poisoning, due to its chelating properties. The presence of the disulfide linkage allows for redox reactions, making it an important player in various biochemical processes. Additionally, penicillamine cysteine disulfide exhibits solubility in water, which facilitates its bioavailability in physiological environments. Its reactivity and interaction with metal ions further enhance its therapeutic potential. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, showcasing the significance of thiol and disulfide chemistry in medicinal applications.
Formula:C8H16N2O4S2
InChI:InChI=1/C8H16N2O4S2/c1-8(2,5(10)7(13)14)16-15-3-4(9)6(11)12/h4-5H,3,9-10H2,1-2H3,(H,11,12)(H,13,14)/t4-,5-/m0/s1
SMILES:CC(C)([C@H](C(=O)O)N)SSC[C@@H](C(=O)O)N
Synonyms:- D-penicillamine cysteine disulfide
- 3-{[(2R)-2-amino-2-carboxyethyl]disulfanyl}-D-valine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
D-Valine, 3-[[(2R)-2-amino-2-carboxyethyl]dithio]-
CAS:Formula:C8H16N2O4S2Color and Shape:SolidMolecular weight:268.3536L-Cysteine-D-penicillamine Disulfide
CAS:Controlled ProductStability Hygroscopic
Applications L-Cysteine-D-penicillamine Disulfide is the major urinary metabolite of D-Penicillamine (P223000). L-Cysteine-D-penicillamine Disulfide exposure induces vacuolation in cultured fibroblasts from individuals with cystinosis.
References Perrett, D.: Proc. Royal Soc. Med., 70, 61 (1977); Waring, R.H. et al.: Xenobiotica, 18, 235 (1988); Schulman, J.D. et al.: Science, 169, 595 (1970);Formula:C8H16N2O4S2Color and Shape:NeatMolecular weight:268.35

