CAS 188416-47-9
:4-(1-bromoethyl)-5-fluoropyrimidine
Description:
4-(1-Bromoethyl)-5-fluoropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromoethyl group at the 4-position and a fluorine atom at the 5-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents, which makes it suitable for various synthetic reactions. The bromine and fluorine substituents can enhance the compound's biological activity, making it of interest in the development of pharmaceuticals, particularly in targeting specific biological pathways. Safety considerations should be taken into account due to the presence of halogens, which can pose health risks if not handled properly. Overall, 4-(1-bromoethyl)-5-fluoropyrimidine is a valuable compound in the field of organic synthesis and drug discovery.
Formula:C6H6BrFN2
InChI:InChI=1/C6H6BrFN2/c1-4(7)6-5(8)2-9-3-10-6/h2-4H,1H3
SMILES:CC(c1c(cncn1)F)Br
Synonyms:- 4-(1-bromoethyl)-5-fluoro-Pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
